Chemistry is the science of change. But why do chemical reactions take place? Why do chemicals react with each other? The answer is in thermodynamics and kinetics, HPLC of Formula: C12H8ClNS, 92-39-7, Name is 2-Chloro-10H-phenothiazine, SMILES is ClC(C=C1N2)=CC=C1SC3=C2C=CC=C3, belongs to thiazines compound. In a document, author is Ghoneim, Amira A., introduce the new discover.
Design, synthesis and anticancer evaluation of novel thiazine, pyrimidine and pyridine derivatives
Acylisothiocyanate (1) was allowed to react with benzylidenemalononitrile producing oxazine derivative (2). Also, compound (1) was reacted with sodium azide followed by refluxing with sodium ethoxide affording thiazinotetrazole derivative (4). The reaction of acetylacetone with compound (1) gave pyridine derivative (5) by intramolecularcycloaddition while it was reacted with N-methyl aniline affording thiazine derivative (7). In addition, it was reacted with cyanoacetamide producing mercaptopyrimidine derivative (9). Finally, compound (1) was refluxed with phenylhydrazine, urea, guanidmum carbonate and anthranilic acid in the presence of dry acetone affording triazole derivative (11), N-substituted pyrimidine (15), compound (18) and thiopyrimidine derivative (19) respectively. The structures of the new compounds were confiimed on the basis of elemental and spectral data. Some of the synthesized compounds were screened as anticancer.
A reaction mechanism is the microscopic path by which reactants are transformed into products. Each step is an elementary reaction. In my other articles, you can also check out more blogs about 92-39-7. HPLC of Formula: C12H8ClNS.
Reference:
Thiazine – an overview | ScienceDirect Topics,
,Thiazine | C4H5NS – PubChem